Compound Q&A

What are the physical and chemical properties of N-Boc Palbociclib (CAS: 1651214-74-2)?

Answer

N-Boc Palbociclib
N-Boc Palbociclib is a crystalline compound with a molecular weight of approximately 555.7 g/mol. It is sparingly soluble in water but soluble in organic solvents like methanol and DMSO. The compound shows good stability under normal conditions but is sensitive to strong bases and acids. CAS: 1651214-74-2

About

English Name N-Boc Palbociclib
Molecular Formula C29H37N7O4
Molecular Weight 547.66 g/mol
SMILES CC(=O)c1c(C)c2cnc(Nc3ccc(cn3)N4CCN(CC4)C(=O)OC(C)(C)C)nc2n(C5CCCC5)c1=O
InChIKey QVJKVBFRYVEWGO-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is N-Boc Palbociclib (CAS: 1651214-74-2) typically synthesized?

N-Boc Palbociclib is synthesized through a multistep process involving protective group chemistry, s...

Compound Q&A

What industries use N-Boc Palbociclib (CAS: 1651214-74-2)?

N-Boc Palbociclib is primarily used in the pharmaceutical industry for the development of anti-cance...

Compound Q&A

What precautions should be taken when handling N-Boc Palbociclib (CAS: 1651214-74-2)?

When handling N-Boc Palbociclib (CAS: 1651214-74-2), it is essential to use personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...