Compound Q&A

What industries use 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone (CAS: 8049-97-6)?

Answer

3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone
This compound is used in the pharmaceutical industry for its potential as a bioactive molecule. It is also employed in the development of sensors and semiconductors due to its unique electronic properties. Additionally, it finds applications in the preparation of certain intermediates in organic synthesis.

About

CAS No 8049-97-6
English Name 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone
Molecular Formula C18H10N2O4
Molecular Weight 318.29 g/mol
SMILES Cc1c2c3c(c[nH]2)c4c5c(c3c(=O)c1=O)c[nH]c5c(c(=O)c4=O)C
InChIKey XUMBMVFBXHLACL-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone (CAS: 8049-97-6)?

This compound is a solid with a crystalline form. Its molecular weight is approximately 414.4 g/mol....

Compound Q&A

How is 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone (CAS: 8049-97-6) typically synthesized?

This compound is typically synthesized via a multistep process involving condensation and ring-closi...

Compound Q&A

What precautions should be taken when handling 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone (CAS: 8049-97-6)?

When handling this compound, appropriate personal protective equipment (PPE) should be worn, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...