Compound Q&A

What are the physical and chemical properties of 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone (CAS: 8049-97-6)?

Answer

3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone
This compound is a solid with a crystalline form. Its molecular weight is approximately 414.4 g/mol. It has low water solubility but is soluble in organic solvents like dichloromethane and acetonitrile. Chemically, it is relatively stable but can undergo ring-opening reactions under certain conditions. It is not reactive with common acids and bases but may react with strong oxidizing agents.

About

CAS No 8049-97-6
English Name 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone
Molecular Formula C18H10N2O4
Molecular Weight 318.29 g/mol
SMILES Cc1c2c3c(c[nH]2)c4c5c(c3c(=O)c1=O)c[nH]c5c(c(=O)c4=O)C
InChIKey XUMBMVFBXHLACL-UHFFFAOYSA-N
Last Updated: 2025-12-25 04:58

Related Q&A

Compound Q&A

How is 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone (CAS: 8049-97-6) typically synthesized?

This compound is typically synthesized via a multistep process involving condensation and ring-closi...

Compound Q&A

What industries use 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone (CAS: 8049-97-6)?

This compound is used in the pharmaceutical industry for its potential as a bioactive molecule. It i...

Compound Q&A

What precautions should be taken when handling 3,8-Dimethyl-2,7-dihydrobenzo[1,7]isoindolo[6,5,4-cd]indole-4,5,9,10-tetrone (CAS: 8049-97-6)?

When handling this compound, appropriate personal protective equipment (PPE) should be worn, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...