Compound Q&A

What are the main uses of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid
(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid is primarily used in research and development for its reactive functional groups. It is utilized in the synthesis of peptides, drugs, and other biologically active molecules. This compound serves as a valuable reagent in organic synthesis and pharmaceutical chemistry.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid
Molecular Formula C23H25NO4
Molecular Weight 379.46 g/mol
SMILES C=CCCCC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c3c1cccc3
InChIKey UAOCBDJIBBTOBI-NRFANRHFSA-N
Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4)?

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid is a synthetic compound with the CA...

Compound Q&A

Is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4) safe?

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4) is generally sa...

Compound Q&A

How should (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4) be stored?

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid should be stored in a cool, dry loc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...