Compound Q&A

What is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4)?

Answer

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid
(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid is a synthetic compound with the CAS number 1251904-51-4. It is an unsaturated amino acid derivative characterized by its unique molecular structure, containing an 8-carbon chain with an amino group, an ester group, and a double bond. This compound is often used in research for its specific functional groups and reactive properties.

About

English Name (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid
Molecular Formula C23H25NO4
Molecular Weight 379.46 g/mol
SMILES C=CCCCC[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2-c3c1cccc3
InChIKey UAOCBDJIBBTOBI-NRFANRHFSA-N
Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What are the main uses of (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4)?

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid is primarily used in research and d...

Compound Q&A

Is (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4) safe?

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4) is generally sa...

Compound Q&A

How should (2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid (CAS: 1251904-51-4) be stored?

(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-7-octenoic acid should be stored in a cool, dry loc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...