Compound Q&A

Is L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) safe?

Answer

L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] is generally safe when used as directed, but proper handling and storage are necessary. Always follow safety guidelines and use appropriate personal protective equipment, such as gloves and goggles, and ensure good ventilation.

About

English Name L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
Molecular Formula C26H25NO5
Molecular Weight 431.48 g/mol
SMILES CCOc1ccc(cc1)C[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2c2c1cccc2
InChIKey XUKUVROJKPSLLU-DEOSSOPVSA-N
Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What is L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1)?

L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) is a synthetic derivativ...

Compound Q&A

What are the main uses of L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1)?

L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) is primarily used in the...

Compound Q&A

How should L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) be stored?

Store L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) at room temperatur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...