Compound Q&A

What are the main uses of L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1)?

Answer

L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) is primarily used in the synthesis of other chemical compounds, as a reagent in organic chemistry, and for research purposes in biochemistry and pharmaceutical development.

About

English Name L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
Molecular Formula C26H25NO5
Molecular Weight 431.48 g/mol
SMILES CCOc1ccc(cc1)C[C@@H](C(=O)O)NC(=O)OCC1c2ccccc2c2c1cccc2
InChIKey XUKUVROJKPSLLU-DEOSSOPVSA-N
Last Updated: 2025-12-25 00:46

Related Q&A

Compound Q&A

What is L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1)?

L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) is a synthetic derivativ...

Compound Q&A

Is L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) safe?

L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] is generally safe when used as directed, bu...

Compound Q&A

How should L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) be stored?

Store L-Tyrosine, O-ethyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl] (CAS: 119894-20-1) at room temperatur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...