Compound Q&A

How should Simvastatin dimer (CAS: 476305-24-5) be stored?

Answer

Simvastatin dimer
Simvastatin dimer (CAS: 476305-24-5) should be stored in a cool, dry place away from direct sunlight and moisture. It should be kept in a tightly sealed container to prevent degradation. It is recommended to store it between 15°C and 25°C (59°F and 77°F) to ensure stability and safety.

About

English Name Simvastatin dimer
Molecular Formula C50H76O10
Molecular Weight 837.13 g/mol
SMILES CCC(C)(C)C(=O)OC1CC(C=C2C1C(C(C=C2)C)CCC3CC(CC(=O)O3)OC(=O)CC(CC(CCC4C(C=CC5=CC(CC(C45)OC(=O)C(C)(C)CC)C)C)O)O)C
InChIKey GUEULYYYHDURDF-UHFFFAOYSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What is Simvastatin dimer (CAS: 476305-24-5)?

Simvastatin dimer (CAS: 476305-24-5) is a chemical compound that consists of two molecules of simvas...

Compound Q&A

What are the main uses of Simvastatin dimer (CAS: 476305-24-5)?

Simvastatin dimer (CAS: 476305-24-5) is primarily used as a precursor for the synthesis of simvastat...

Compound Q&A

Is Simvastatin dimer (CAS: 476305-24-5) safe?

Simvastatin dimer (CAS: 476305-24-5) is generally safe when handled with proper precautions, such as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...