Compound Q&A

What are the main uses of Simvastatin dimer (CAS: 476305-24-5)?

Answer

Simvastatin dimer
Simvastatin dimer (CAS: 476305-24-5) is primarily used as a precursor for the synthesis of simvastatin, a cholesterol-lowering medication. It is not used directly in medical applications but is crucial for the production of the active drug.

About

English Name Simvastatin dimer
Molecular Formula C50H76O10
Molecular Weight 837.13 g/mol
SMILES CCC(C)(C)C(=O)OC1CC(C=C2C1C(C(C=C2)C)CCC3CC(CC(=O)O3)OC(=O)CC(CC(CCC4C(C=CC5=CC(CC(C45)OC(=O)C(C)(C)CC)C)C)O)O)C
InChIKey GUEULYYYHDURDF-UHFFFAOYSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What is Simvastatin dimer (CAS: 476305-24-5)?

Simvastatin dimer (CAS: 476305-24-5) is a chemical compound that consists of two molecules of simvas...

Compound Q&A

Is Simvastatin dimer (CAS: 476305-24-5) safe?

Simvastatin dimer (CAS: 476305-24-5) is generally safe when handled with proper precautions, such as...

Compound Q&A

How should Simvastatin dimer (CAS: 476305-24-5) be stored?

Simvastatin dimer (CAS: 476305-24-5) should be stored in a cool, dry place away from direct sunlight...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...