Compound Q&A

What are the main uses of BPDC-(OH)2 (CAS: 861533-46-2)?

Answer

BPDC-(OH)2
BPDC-(OH)2 (CAS: 861533-46-2) is primarily used in the synthesis of polymers and in materials science due to its ability to form stable structures. It is also used in the development of new adhesives and coatings.

About

English Name BPDC-(OH)2
Molecular Formula C14H10O6
Molecular Weight 274.23 g/mol
SMILES OC1=C(C(O)=O)C=CC(C2=CC(O)=C(C(O)=O)C=C2)=C1
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What is BPDC-(OH)2 (CAS: 861533-46-2)?

BPDC-(OH)2 (CAS: 861533-46-2) is a bisphenol-derived compound with a hydroxyl functional group. It i...

Compound Q&A

Is BPDC-(OH)2 (CAS: 861533-46-2) safe?

BPDC-(OH)2 (CAS: 861533-46-2) is generally considered safe when handled with proper precautions. How...

Compound Q&A

How should BPDC-(OH)2 (CAS: 861533-46-2) be stored?

BPDC-(OH)2 (CAS: 861533-46-2) should be stored in a cool, dry place away from direct sunlight and he...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...