Compound Q&A

What is BPDC-(OH)2 (CAS: 861533-46-2)?

Answer

BPDC-(OH)2
BPDC-(OH)2 (CAS: 861533-46-2) is a bisphenol-derived compound with a hydroxyl functional group. It is an aromatic compound with a molecular formula of C14H12O4. This compound is known for its stability and reactivity in various chemical processes.

About

English Name BPDC-(OH)2
Molecular Formula C14H10O6
Molecular Weight 274.23 g/mol
SMILES OC1=C(C(O)=O)C=CC(C2=CC(O)=C(C(O)=O)C=C2)=C1
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What are the main uses of BPDC-(OH)2 (CAS: 861533-46-2)?

BPDC-(OH)2 (CAS: 861533-46-2) is primarily used in the synthesis of polymers and in materials scienc...

Compound Q&A

Is BPDC-(OH)2 (CAS: 861533-46-2) safe?

BPDC-(OH)2 (CAS: 861533-46-2) is generally considered safe when handled with proper precautions. How...

Compound Q&A

How should BPDC-(OH)2 (CAS: 861533-46-2) be stored?

BPDC-(OH)2 (CAS: 861533-46-2) should be stored in a cool, dry place away from direct sunlight and he...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...