Compound Q&A

Is Biotin-PEG4-methyltetrazine (CAS: 1835759-81-3) safe?

Answer

Biotin-PEG4-methyltetrazine
Biotin-PEG4-methyltetrazine is generally considered safe for most applications. However, proper handling and storage should be followed, and appropriate personal protective equipment (PPE) should be used to minimize exposure. Ensure to follow all safety guidelines provided by the manufacturer.

About

English Name Biotin-PEG4-methyltetrazine
Molecular Formula C27H39N7O6S
Molecular Weight 589.71 g/mol
SMILES O=C(NCCOCCOCCOCCOc1ccc(cc1)c1nnc(nn1)C)CCCC[C@H]1SC[C@@H]2[C@H]1NC(=O)N2
InChIKey FTGDGKKLLGMCLG-VDKIKQQVSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What is Biotin-PEG4-methyltetrazine (CAS: 1835759-81-3)?

Biotin-PEG4-methyltetrazine is a chemical compound with the CAS number 1835759-81-3. It is a conjuga...

Compound Q&A

What are the main uses of Biotin-PEG4-methyltetrazine (CAS: 1835759-81-3)?

Biotin-PEG4-methyltetrazine is primarily used in bioconjugation reactions, drug delivery systems, an...

Compound Q&A

How should Biotin-PEG4-methyltetrazine (CAS: 1835759-81-3) be stored?

Biotin-PEG4-methyltetrazine should be stored in a cool, dark place away from direct sunlight and moi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...