Compound Q&A

What is Biotin-PEG4-methyltetrazine (CAS: 1835759-81-3)?

Answer

Biotin-PEG4-methyltetrazine
Biotin-PEG4-methyltetrazine is a chemical compound with the CAS number 1835759-81-3. It is a conjugate of biotin, polyethylene glycol (PEG), and methyltetrazine, used for bioconjugation and labeling in various applications.

About

English Name Biotin-PEG4-methyltetrazine
Molecular Formula C27H39N7O6S
Molecular Weight 589.71 g/mol
SMILES O=C(NCCOCCOCCOCCOc1ccc(cc1)c1nnc(nn1)C)CCCC[C@H]1SC[C@@H]2[C@H]1NC(=O)N2
InChIKey FTGDGKKLLGMCLG-VDKIKQQVSA-N
Last Updated: 2025-12-24 21:16

Related Q&A

Compound Q&A

What are the main uses of Biotin-PEG4-methyltetrazine (CAS: 1835759-81-3)?

Biotin-PEG4-methyltetrazine is primarily used in bioconjugation reactions, drug delivery systems, an...

Compound Q&A

Is Biotin-PEG4-methyltetrazine (CAS: 1835759-81-3) safe?

Biotin-PEG4-methyltetrazine is generally considered safe for most applications. However, proper hand...

Compound Q&A

How should Biotin-PEG4-methyltetrazine (CAS: 1835759-81-3) be stored?

Biotin-PEG4-methyltetrazine should be stored in a cool, dark place away from direct sunlight and moi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...