Compound Q&A

Is (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole) (CAS: 182122-08-3) safe?

Answer

(3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole)
The safety of this compound depends on the specific context of its use. Generally, it is not considered inherently toxic, but proper handling and use under controlled conditions are essential. Protective measures should be taken, including the use of personal protective equipment and appropriate storage conditions to minimize any potential risks.

About

English Name (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole)
Molecular Formula C23H20N2O2
Molecular Weight 356.43 g/mol
SMILES c1ccc2c(c1)C1N=C(O[C@@H]1C2)C1(CC1)C1=N[C@@H]2C(O1)Cc1c2cccc1
InChIKey QFXUVUBVPPOPQZ-OAHAVBBTSA-N
Last Updated: 2025-12-24 16:21

Related Q&A

Compound Q&A

What is (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole) (CAS: 182122-08-3)?

This compound is a bis-indeno-oxazole derivative with a cyclopropane bridge. It is a complex organic...

Compound Q&A

What are the main uses of (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole) (CAS: 182122-08-3)?

This compound is primarily used as an intermediate in the synthesis of other organic molecules. It m...

Compound Q&A

How should (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole) (CAS: 182122-08-3) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and sources of ignitio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...