Compound Q&A

What is (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole) (CAS: 182122-08-3)?

Answer

(3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole)
This compound is a bis-indeno-oxazole derivative with a cyclopropane bridge. It is a complex organic molecule with a unique structure. It is characterized by its specific stereochemistry and functional groups, making it a valuable intermediate in organic synthesis.

About

English Name (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole)
Molecular Formula C23H20N2O2
Molecular Weight 356.43 g/mol
SMILES c1ccc2c(c1)C1N=C(O[C@@H]1C2)C1(CC1)C1=N[C@@H]2C(O1)Cc1c2cccc1
InChIKey QFXUVUBVPPOPQZ-OAHAVBBTSA-N
Last Updated: 2025-12-24 16:21

Related Q&A

Compound Q&A

What are the main uses of (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole) (CAS: 182122-08-3)?

This compound is primarily used as an intermediate in the synthesis of other organic molecules. It m...

Compound Q&A

Is (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole) (CAS: 182122-08-3) safe?

The safety of this compound depends on the specific context of its use. Generally, it is not conside...

Compound Q&A

How should (3aS,3a'S,8aR,8a'R)-2,2'-(Cyclopropane-1,1-diyl)bis(8,8a-dihydro-3aH-indeno[1,2-d]oxazole) (CAS: 182122-08-3) be stored?

This compound should be stored in a cool, dry place away from direct sunlight and sources of ignitio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...