Compound Q&A

What are the main uses of Linezolid Dimer (CAS: 908143-04-4)?

Answer

Linezolid Dimer
Linezolid Dimer (CAS: 908143-04-4) is primarily used in the treatment of serious infections caused by certain bacteria, particularly in cases where standard antibiotics are ineffective or not suitable. It is often prescribed for conditions such as pneumonia and skin infections.

About

English Name Linezolid Dimer
Molecular Formula C30H35F2N5O7
Molecular Weight 615.63 g/mol
SMILES CC(=O)N(CC1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F)CC4CN(C(=O)O4)C5=CC(=C(C=C5)N6CCOCC6)F
InChIKey KZYMHNDGSFJVMU-ZEQRLZLVSA-N
Last Updated: 2025-12-24 12:09

Related Q&A

Compound Q&A

What is Linezolid Dimer (CAS: 908143-04-4)?

Linezolid Dimer (CAS: 908143-04-4) is a chemical compound that exists as a dimer of linezolid, a syn...

Compound Q&A

Is Linezolid Dimer (CAS: 908143-04-4) safe?

Linezolid Dimer (CAS: 908143-04-4) is generally considered safe when used as directed. However, it i...

Compound Q&A

How should Linezolid Dimer (CAS: 908143-04-4) be stored?

Linezolid Dimer (CAS: 908143-04-4) should be stored in a tightly sealed container, protected from li...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...