Compound Q&A

What is Linezolid Dimer (CAS: 908143-04-4)?

Answer

Linezolid Dimer
Linezolid Dimer (CAS: 908143-04-4) is a chemical compound that exists as a dimer of linezolid, a synthetic antibiotic used to treat serious bacterial infections. It is characterized by its unique structure and improved pharmacological properties compared to its monomeric form.

About

English Name Linezolid Dimer
Molecular Formula C30H35F2N5O7
Molecular Weight 615.63 g/mol
SMILES CC(=O)N(CC1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F)CC4CN(C(=O)O4)C5=CC(=C(C=C5)N6CCOCC6)F
InChIKey KZYMHNDGSFJVMU-ZEQRLZLVSA-N
Last Updated: 2025-12-24 12:09

Related Q&A

Compound Q&A

What are the main uses of Linezolid Dimer (CAS: 908143-04-4)?

Linezolid Dimer (CAS: 908143-04-4) is primarily used in the treatment of serious infections caused b...

Compound Q&A

Is Linezolid Dimer (CAS: 908143-04-4) safe?

Linezolid Dimer (CAS: 908143-04-4) is generally considered safe when used as directed. However, it i...

Compound Q&A

How should Linezolid Dimer (CAS: 908143-04-4) be stored?

Linezolid Dimer (CAS: 908143-04-4) should be stored in a tightly sealed container, protected from li...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...