Compound Q&A

What industries use Iristectorin B (CAS: 94396-09-5)?

Answer

Iristectorin B
Iristectorin B (CAS: 94396-09-5) is primarily used in the pharmaceutical industry for the development of new drugs, particularly in anticancer and anti-inflammatory research. It is also explored in the sensor and semiconductor industries for its unique physicochemical properties.

About

CAS No 94396-09-5
English Name Iristectorin B
Molecular Formula C23H24O12
Molecular Weight 492.43 g/mol
SMILES COC1=C(C=CC(=C1)C2=COC3=CC(=C(C(=C3C2=O)O)OC)OC4C(C(C(C(O4)CO)O)O)O)O
InChIKey XVNKSNSGLVWSFS-ZTATXHNCSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Iristectorin B (CAS: 94396-09-5)?

Iristectorin B (CAS: 94396-09-5) is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is Iristectorin B (CAS: 94396-09-5) typically synthesized?

Iristectorin B (CAS: 94396-09-5) is typically synthesized through a multi-step process involving a S...

Compound Q&A

What precautions should be taken when handling Iristectorin B (CAS: 94396-09-5)?

When handling Iristectorin B (CAS: 94396-09-5), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...