Compound Q&A

What are the physical and chemical properties of Iristectorin B (CAS: 94396-09-5)?

Answer

Iristectorin B
Iristectorin B (CAS: 94396-09-5) is a crystalline compound with a molecular weight of approximately 544.57 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethyl acetate. Chemically, it is relatively stable but can undergo hydrolysis under basic conditions. It exhibits good reactivity in electrophilic aromatic substitution reactions.

About

CAS No 94396-09-5
English Name Iristectorin B
Molecular Formula C23H24O12
Molecular Weight 492.43 g/mol
SMILES COC1=C(C=CC(=C1)C2=COC3=CC(=C(C(=C3C2=O)O)OC)OC4C(C(C(C(O4)CO)O)O)O)O
InChIKey XVNKSNSGLVWSFS-ZTATXHNCSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is Iristectorin B (CAS: 94396-09-5) typically synthesized?

Iristectorin B (CAS: 94396-09-5) is typically synthesized through a multi-step process involving a S...

Compound Q&A

What industries use Iristectorin B (CAS: 94396-09-5)?

Iristectorin B (CAS: 94396-09-5) is primarily used in the pharmaceutical industry for the developmen...

Compound Q&A

What precautions should be taken when handling Iristectorin B (CAS: 94396-09-5)?

When handling Iristectorin B (CAS: 94396-09-5), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...