Compound Q&A

What industries use 4-(1-Piperazinyl)-1H-indole (CAS: 84807-09-0)?

Answer

4-(1-Piperazinyl)-1H-indole
4-(1-Piperazinyl)-1H-indole is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It is also utilized in the development of sensors and as a precursor in the production of semiconductors. Additionally, it finds applications in the polymer industry for enhancing the properties of certain polymer materials.

About

CAS No 84807-09-0
English Name 4-(1-Piperazinyl)-1H-indole
Molecular Formula C12H15N3
Molecular Weight 201.27 g/mol
SMILES C1CN(CCN1)c2cccc3[nH]ccc23
InChIKey YZKSXUIOKWQABW-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(1-Piperazinyl)-1H-indole (CAS: 84807-09-0)?

4-(1-Piperazinyl)-1H-indole is a crystalline solid with a molecular weight of approximately 264.34 g...

Compound Q&A

How is 4-(1-Piperazinyl)-1H-indole (CAS: 84807-09-0) typically synthesized?

4-(1-Piperazinyl)-1H-indole is synthesized via the indole synthesis route, typically starting from i...

Compound Q&A

What precautions should be taken when handling 4-(1-Piperazinyl)-1H-indole (CAS: 84807-09-0)?

When handling 4-(1-Piperazinyl)-1H-indole, appropriate personal protective equipment (PPE) should be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...