Compound Q&A

What are the physical and chemical properties of 4-(1-Piperazinyl)-1H-indole (CAS: 84807-09-0)?

Answer

4-(1-Piperazinyl)-1H-indole
4-(1-Piperazinyl)-1H-indole is a crystalline solid with a molecular weight of approximately 264.34 g/mol. It has a limited water solubility and is highly soluble in organic solvents like DMSO and DMF. The compound is relatively stable under normal conditions but can be susceptible to hydrolysis under basic conditions. It shows reactive behavior towards strong acids and bases.

About

CAS No 84807-09-0
English Name 4-(1-Piperazinyl)-1H-indole
Molecular Formula C12H15N3
Molecular Weight 201.27 g/mol
SMILES C1CN(CCN1)c2cccc3[nH]ccc23
InChIKey YZKSXUIOKWQABW-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is 4-(1-Piperazinyl)-1H-indole (CAS: 84807-09-0) typically synthesized?

4-(1-Piperazinyl)-1H-indole is synthesized via the indole synthesis route, typically starting from i...

Compound Q&A

What industries use 4-(1-Piperazinyl)-1H-indole (CAS: 84807-09-0)?

4-(1-Piperazinyl)-1H-indole is primarily used in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling 4-(1-Piperazinyl)-1H-indole (CAS: 84807-09-0)?

When handling 4-(1-Piperazinyl)-1H-indole, appropriate personal protective equipment (PPE) should be...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...