Compound Q&A

How is 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid (CAS: 21752-36-3) typically synthesized?

Answer

2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid
2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid can be synthesized through a multi-step process involving the reaction of phenylacetic acid with phenylethyl isocyanate. Commonly, this involves the formation of the isocyanate followed by its reaction with benzoic acid to form the final product. The process typically yields about 75-85% purity with good selectivity.

About

CAS No 21752-36-3
English Name 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid
Molecular Formula C16H15NO3
Molecular Weight 269.3 g/mol
SMILES CC(C1=CC=CC=C1)NC(=O)C2=CC=CC=C2C(=O)O
InChIKey VCFKXWGKKDZMPO-NSHDSACASA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid (CAS: 21752-36-3)?

2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid is a solid with a crystalline form. Its molecular weig...

Compound Q&A

What industries use 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid (CAS: 21752-36-3)?

2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid is used in the pharmaceutical industry for the develop...

Compound Q&A

What precautions should be taken when handling 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid (CAS: 21752-36-3)?

When handling 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid, it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...