Compound Q&A

What are the physical and chemical properties of 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid (CAS: 21752-36-3)?

Answer

2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid
2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid is a solid with a crystalline form. Its molecular weight is approximately 289.31 g/mol. It has a melting point of 225-227°C and is slightly soluble in water. This compound exhibits moderate reactivity in acidic conditions. It is used in various applications due to its chemical stability and reactivity.

About

CAS No 21752-36-3
English Name 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid
Molecular Formula C16H15NO3
Molecular Weight 269.3 g/mol
SMILES CC(C1=CC=CC=C1)NC(=O)C2=CC=CC=C2C(=O)O
InChIKey VCFKXWGKKDZMPO-NSHDSACASA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid (CAS: 21752-36-3) typically synthesized?

2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid can be synthesized through a multi-step process involv...

Compound Q&A

What industries use 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid (CAS: 21752-36-3)?

2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid is used in the pharmaceutical industry for the develop...

Compound Q&A

What precautions should be taken when handling 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid (CAS: 21752-36-3)?

When handling 2-{[(1S)-1-Phenylethyl]carbamoyl}benzoic acid, it is important to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...