Compound Q&A

How is [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6) typically synthesized?

Answer

[(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate
[(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6) can be synthesized via a multi-step process. First, 4-nitrobenzoic acid is reacted with (2R)-2-methyl oxirane in the presence of a base such as sodium hydride. This step forms a salt intermediate, which is then treated with methyl chloroformate to obtain the ester. The overall process is selective and yields a product with a purity of over 98%.

About

English Name [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate
Molecular Formula C11H11NO5
Molecular Weight 237.21 g/mol
SMILES CC1(CO1)COC(=O)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey PUBTVFBOTFDPTA-NSHDSACASA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6)?

[(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6) is a white crystalline solid wit...

Compound Q&A

What industries use [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6)?

[(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6)?

When handling [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...