Compound Q&A

What are the physical and chemical properties of [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6)?

Answer

[(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate
[(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6) is a white crystalline solid with a molecular weight of approximately 258.12 g/mol. It has a melting point of 99-101°C and is soluble in chloroform, methanol, and acetonitrile but less so in water. This compound is known for its reactivity in nucleophilic substitution reactions and can undergo electrophilic aromatic substitution due to the nitro group.

About

English Name [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate
Molecular Formula C11H11NO5
Molecular Weight 237.21 g/mol
SMILES CC1(CO1)COC(=O)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey PUBTVFBOTFDPTA-NSHDSACASA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6) typically synthesized?

[(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6) can be synthesized via a multi-s...

Compound Q&A

What industries use [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6)?

[(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6) is primarily used in the pharmac...

Compound Q&A

What precautions should be taken when handling [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6)?

When handling [(2R)-2-Methyl-2-oxiranyl]methyl 4-nitrobenzoate (CAS: 106268-96-6), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...