Compound Q&A

What industries use 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (CAS: 41569-33-9)?

Answer

1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose
This compound is primarily used in the pharmaceutical industry for the synthesis of complex carbohydrates and glycoconjugates. It also finds applications in the production of certain sensors and as a reagent in the research of polymer chemistry. Its use in semiconductors is less common but can be relevant in specialized applications requiring specific molecular properties.

About

CAS No 41569-33-9
English Name 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose
Molecular Formula C41H32O11
Molecular Weight 700.7 g/mol
SMILES c1ccc(cc1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@@H]([C@H](O2)OC(=O)c3ccccc3)OC(=O)c4ccccc4)OC(=O)c5ccccc5)OC(=O)c6ccccc6
InChIKey JJNMLNFZFGSWQR-LAWAEFJSSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (CAS: 41569-33-9)?

1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose has a crystalline form with a molecular weight of ap...

Compound Q&A

How is 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (CAS: 41569-33-9) typically synthesized?

1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose is synthesized via a multi-step process involving th...

Compound Q&A

What precautions should be taken when handling 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (CAS: 41569-33-9)?

Handling 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose requires the use of personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...