Compound Q&A

What are the physical and chemical properties of 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (CAS: 41569-33-9)?

Answer

1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose
1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose has a crystalline form with a molecular weight of approximately 574.7 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol and ethanol. Chemically, it is highly reactive with benzoyl groups, making it useful for various derivatization reactions. It exhibits good stability under neutral and slightly acidic conditions.

About

CAS No 41569-33-9
English Name 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose
Molecular Formula C41H32O11
Molecular Weight 700.7 g/mol
SMILES c1ccc(cc1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@@H]([C@H](O2)OC(=O)c3ccccc3)OC(=O)c4ccccc4)OC(=O)c5ccccc5)OC(=O)c6ccccc6
InChIKey JJNMLNFZFGSWQR-LAWAEFJSSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (CAS: 41569-33-9) typically synthesized?

1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose is synthesized via a multi-step process involving th...

Compound Q&A

What industries use 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (CAS: 41569-33-9)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex carbohyd...

Compound Q&A

What precautions should be taken when handling 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose (CAS: 41569-33-9)?

Handling 1,2,3,4,6-Penta-O-benzoyl-alpha-D-mannopyranose requires the use of personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...