Compound Q&A

What industries use (+/-)9-HODE (CAS: 98524-19-7)?

Answer

(+/-)9-HODE
(+/-)9-HODE is primarily used in the pharmaceutical industry for the development of anti-inflammatory drugs and prostaglandin modulators. It is also applied in the food and cosmetic industries for its antioxidant properties. Additionally, it finds utility in the polymer industry for enhancing the properties of polymer composites.

About

CAS No 98524-19-7
English Name (+/-)9-HODE
Molecular Formula C18H32O3
Molecular Weight 296.45 g/mol
SMILES CCCCCC=CC=CC(CCCCCCCC(=O)O)O
InChIKey NPDSHTNEKLQQIJ-ZJHFMPGASA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (+/-)9-HODE (CAS: 98524-19-7)?

The physical properties of (+/-)9-HODE include a white crystalline form with a molecular weight of a...

Compound Q&A

How is (+/-)9-HODE (CAS: 98524-19-7) typically synthesized?

(+/-)9-HODE is typically synthesized through the hydrolysis of arachidonic acid followed by hydroge...

Compound Q&A

What precautions should be taken when handling (+/-)9-HODE (CAS: 98524-19-7)?

When handling (+/-)9-HODE, it is essential to wear appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...