Compound Q&A

What are the physical and chemical properties of (+/-)9-HODE (CAS: 98524-19-7)?

Answer

(+/-)9-HODE
The physical properties of (+/-)9-HODE include a white crystalline form with a molecular weight of approximately 304.33 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetonitrile. Chemically, it is highly reactive due to the presence of a double bond, which makes it prone to oxidation and other electrophilic additions.

About

CAS No 98524-19-7
English Name (+/-)9-HODE
Molecular Formula C18H32O3
Molecular Weight 296.45 g/mol
SMILES CCCCCC=CC=CC(CCCCCCCC(=O)O)O
InChIKey NPDSHTNEKLQQIJ-ZJHFMPGASA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is (+/-)9-HODE (CAS: 98524-19-7) typically synthesized?

(+/-)9-HODE is typically synthesized through the hydrolysis of arachidonic acid followed by hydroge...

Compound Q&A

What industries use (+/-)9-HODE (CAS: 98524-19-7)?

(+/-)9-HODE is primarily used in the pharmaceutical industry for the development of anti-inflammato...

Compound Q&A

What precautions should be taken when handling (+/-)9-HODE (CAS: 98524-19-7)?

When handling (+/-)9-HODE, it is essential to wear appropriate personal protective equipment (PPE) s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...