Compound Q&A

What precautions should be taken when handling Proflavine (CAS: 92-62-6)?

Answer

Proflavine
When handling Proflavine (CAS: 92-62-6), proper personal protective equipment (PPE) should be worn, including gloves, goggles, and a laboratory coat. Proflavine should be stored in a well-ventilated area away from heat sources. If a spill occurs, it should be managed carefully, and appropriate safety data sheets (SDS) should be consulted for specific procedures. Fume hoods should be used during handling to minimize inhalation risk.

About

CAS No 92-62-6
English Name Proflavine
Molecular Formula C13H11N3
Molecular Weight 209.25 g/mol
SMILES C1=CC(=CC2=NC3=C(C=CC(=C3)N)C=C21)N
InChIKey WDVSHHCDHLJJJR-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Proflavine (CAS: 92-62-6)?

Proflavine (CAS: 92-62-6) is a yellow crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is Proflavine (CAS: 92-62-6) typically synthesized?

Proflavine (CAS: 92-62-6) can be synthesized by the condensation of 4-dimethylaminobenzaldehyde with...

Compound Q&A

What industries use Proflavine (CAS: 92-62-6)?

Proflavine (CAS: 92-62-6) is primarily used in the pharmaceutical industry as a preservative and dye...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...