Compound Q&A

How is (S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride (CAS: 213018-92-9) typically synthesized?

Answer

(S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride
(S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride can be synthesized via the esterification of 2-chlorophenylglycine with methanol, followed by the addition of hydrochloric acid to form the hydrochloride salt. The reaction typically yields a high selectivity and good yield, with the use of a catalyst like a Lewis acid to enhance the reaction rate.

About

English Name (S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride
Molecular Formula C9H11Cl2NO2
Molecular Weight 236.09 g/mol
SMILES COC(=O)C(C1=CC=CC=C1Cl)N.Cl
InChIKey SUUNIMMHDPICBD-QRPNPIFTSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride (CAS: 213018-92-9)?

(S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride is a white crystalline powder with a molecu...

Compound Q&A

What industries use (S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride (CAS: 213018-92-9)?

(S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride is primarily used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling (S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride (CAS: 213018-92-9)?

When handling (S)-(+)-2-Chlorophenylglycine Methyl Ester Hydrochloride, wear appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...