Compound Q&A

How is (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate (CAS: 163041-94-9) typically synthesized?

Answer

(3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate
(3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate is typically synthesized via a hydrogenation process of 11-methyl-3,8-dodecadien-1-ol followed by acetylation. The hydrogenation step is often catalyzed by palladium on carbon, and the acetylation is catalyzed by an acid catalyst. The process yields around 85% of the target compound with good selectivity towards the desired isomer.

About

English Name (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate
Molecular Formula C16H26O2
Molecular Weight 250.38 g/mol
SMILES CC/C=C\C/C=C\CCC/C=C/CCOC(=O)C
InChIKey HWPJPNQEVWTZSJ-XBZOLNABSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate (CAS: 163041-94-9)?

(3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate is a colorless liquid with a fruity aroma at room tem...

Compound Q&A

What industries use (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate (CAS: 163041-94-9)?

(3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate finds application in the fragrance and flavor industr...

Compound Q&A

What precautions should be taken when handling (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate (CAS: 163041-94-9)?

When handling (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...