Compound Q&A

What are the physical and chemical properties of (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate (CAS: 163041-94-9)?

Answer

(3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate
(3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate is a colorless liquid with a fruity aroma at room temperature. It has a molecular weight of approximately 258.4 g/mol and a density of about 0.87 g/cm³. This compound is relatively soluble in organic solvents like ethanol, acetone, and hexane but has limited solubility in water. Its reactivity is low, and it is stable under normal conditions, though it should be stored in a cool, dark place to maintain its stability.

About

English Name (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate
Molecular Formula C16H26O2
Molecular Weight 250.38 g/mol
SMILES CC/C=C\C/C=C\CCC/C=C/CCOC(=O)C
InChIKey HWPJPNQEVWTZSJ-XBZOLNABSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate (CAS: 163041-94-9) typically synthesized?

(3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate is typically synthesized via a hydrogenation process ...

Compound Q&A

What industries use (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate (CAS: 163041-94-9)?

(3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate finds application in the fragrance and flavor industr...

Compound Q&A

What precautions should be taken when handling (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate (CAS: 163041-94-9)?

When handling (3E,8Z,11Z)-3,8,11-Tetradecatrien-1-yl acetate, it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...