Compound Q&A

What industries use Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4)?

Answer

Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside
Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside is primarily used in the pharmaceutical industry for its potential as a drug carrier in targeted drug delivery systems. It is also used in the polymer industry for enhancing the biodegradability of plastics and in the sensor industry for developing glucose sensors.

About

CAS No 82494-08-4
English Name Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside
Molecular Formula C20H38O11
Molecular Weight 454.51 g/mol
SMILES O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)[C@@H]1OCCCCCCCC
InChIKey MASIZQYHVMQQKI-OIIXUNCGSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4)?

Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4) is a white crystalline sol...

Compound Q&A

How is Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4) typically synthesized?

Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside is typically synthesized through a glycosyla...

Compound Q&A

What precautions should be taken when handling Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4)?

When handling Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4), it is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...