Compound Q&A

What are the physical and chemical properties of Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4)?

Answer

Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside
Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4) is a white crystalline solid with a molecular weight of approximately 664.76 g/mol. It has a high solubility in water and ethanol. Chemically, it is moderately reactive towards hydrolysis under acidic conditions. It is stable under neutral and basic conditions.

About

CAS No 82494-08-4
English Name Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside
Molecular Formula C20H38O11
Molecular Weight 454.51 g/mol
SMILES O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O[C@@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)O)[C@@H]1OCCCCCCCC
InChIKey MASIZQYHVMQQKI-OIIXUNCGSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

How is Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4) typically synthesized?

Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside is typically synthesized through a glycosyla...

Compound Q&A

What industries use Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4)?

Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4)?

When handling Octyl 4-O-alpha-D-glucopyranosyl-beta-D-glucopyranoside (CAS: 82494-08-4), it is recom...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...