Compound Q&A

What industries use KU14R (CAS: 189222-48-4)?

Answer

KU14R
KU14R is primarily used in the pharmaceutical industry for developing novel drug candidates. It is also explored in the polymer industry for its potential as a monomer or additive, and in the semiconductor industry for its role in thin film processes. Additionally, KU14R may be used in the sensor industry for its sensitivity to specific analytes.

About

English Name KU14R
Molecular Formula C13H14N2O
Molecular Weight 214.27 g/mol
SMILES CCC1(CC2=CC=CC=C2O1)C3=NC=CN3
InChIKey JCWVNNMJXQJVNC-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of KU14R (CAS: 189222-48-4)?

KU14R is a white crystalline powder with a molecular weight of approximately 424.29 g/mol. It is spa...

Compound Q&A

How is KU14R (CAS: 189222-48-4) typically synthesized?

KU14R is synthesized through a multi-step organic synthesis process involving condensation reactions...

Compound Q&A

What precautions should be taken when handling KU14R (CAS: 189222-48-4)?

When handling KU14R, ensure proper personal protective equipment (PPE) such as gloves, goggles, and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...