Compound Q&A

How is KU14R (CAS: 189222-48-4) typically synthesized?

Answer

KU14R
KU14R is synthesized through a multi-step organic synthesis process involving condensation reactions, ring formation, and deprotection steps. Commonly used catalysts include various transition metals and Lewis acids. The overall yield ranges from 50% to 70%, depending on the purity of the precursors and the efficiency of the reaction steps.

About

English Name KU14R
Molecular Formula C13H14N2O
Molecular Weight 214.27 g/mol
SMILES CCC1(CC2=CC=CC=C2O1)C3=NC=CN3
InChIKey JCWVNNMJXQJVNC-UHFFFAOYSA-N
Last Updated: 2025-11-28 19:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of KU14R (CAS: 189222-48-4)?

KU14R is a white crystalline powder with a molecular weight of approximately 424.29 g/mol. It is spa...

Compound Q&A

What industries use KU14R (CAS: 189222-48-4)?

KU14R is primarily used in the pharmaceutical industry for developing novel drug candidates. It is a...

Compound Q&A

What precautions should be taken when handling KU14R (CAS: 189222-48-4)?

When handling KU14R, ensure proper personal protective equipment (PPE) such as gloves, goggles, and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...