Compound Q&A

Is 3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) safe?

Answer

3-(1-Piperidinylsulfonyl)benzoic acid
3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) is generally considered safe when handled properly. However, it should be used with caution and appropriate protective measures, such as gloves and goggles, to prevent skin and eye contact. Immediate medical attention should be sought if exposure occurs.

About

CAS No 7311-93-5
English Name 3-(1-Piperidinylsulfonyl)benzoic acid
Molecular Formula C12H15NO4S
Molecular Weight 269.32 g/mol
SMILES C1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O
InChIKey QRFCJPBEPZZXEE-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What is 3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5)?

3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) is a chemical compound with a unique structur...

Compound Q&A

What are the main uses of 3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5)?

3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) is primarily used in the pharmaceutical indus...

Compound Q&A

How should 3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) be stored?

3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...