Compound Q&A

What is 3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5)?

Answer

3-(1-Piperidinylsulfonyl)benzoic acid
3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) is a chemical compound with a unique structure that includes a benzene ring and a piperidine sulfone group. It is a white to off-white solid with a melting point around 191°C. This compound is used in various applications, including pharmaceuticals and research.

About

CAS No 7311-93-5
English Name 3-(1-Piperidinylsulfonyl)benzoic acid
Molecular Formula C12H15NO4S
Molecular Weight 269.32 g/mol
SMILES C1CCN(CC1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O
InChIKey QRFCJPBEPZZXEE-UHFFFAOYSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the main uses of 3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5)?

3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) is primarily used in the pharmaceutical indus...

Compound Q&A

Is 3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) safe?

3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) is generally considered safe when handled pro...

Compound Q&A

How should 3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) be stored?

3-(1-Piperidinylsulfonyl)benzoic acid (CAS: 7311-93-5) should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...