Compound Q&A

What industries use (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

Answer

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid
(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid finds applications in the pharmaceutical industry, where it serves as a building block for peptide synthesis. It is also utilized in the production of polymers and sensors, due to its unique chemical properties. In the semiconductor industry, it may be used in the development of specific components requiring high purity.

About

English Name (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid
Molecular Formula C25H28N2O6
Molecular Weight 452.5070000000002 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
InChIKey ZVHNNCSUTNWKFC-NRFANRHFSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid is a white crystalline solid with a molecular weig...

Compound Q&A

How is (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5) typically synthesized?

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid is synthesized through a multi-step process, typic...

Compound Q&A

What precautions should be taken when handling (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

When handling (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid, it is essential to wear appropriate...

Compound Q&A

What are the main uses of Ethyl N-2-pyridinyl-beta-alaninate (CAS: 103041-38-9)?

Ethyl N-2-pyridinyl-beta-alaninate is primarily used in the pharmaceutical indus...

103041-38-9Ethyl N-2-pyridinyl-...
Compound Q&A

Are there alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1) in synthesis?

There are alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1)...

1211584-54-15H-pyrrolo[3,4-b]pyr...
Compound Q&A

What industries use 2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride (CAS: 1353945-59-1)?

2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride is used in the pha...

1353945-59-12-{[(4-Chlorophenyl)...
Compound Q&A

How should Caesium chloride (CAS: 7647-17-8) be stored?

Caesium chloride should be stored in a cool, dry place (ideally 20-25°C), away f...

7647-17-8Caesium chloride