Compound Q&A

What are the physical and chemical properties of (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

Answer

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid
(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid is a white crystalline solid with a molecular weight of approximately 535.56 g/mol. It has a pKa of about 6.5 and is soluble in common organic solvents like DMSO and DMF but less soluble in water. This compound is known for its reactivity in ester formation and amide bond formation, making it valuable in peptide synthesis.

About

English Name (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid
Molecular Formula C25H28N2O6
Molecular Weight 452.5070000000002 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
InChIKey ZVHNNCSUTNWKFC-NRFANRHFSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

How is (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5) typically synthesized?

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid is synthesized through a multi-step process, typic...

Compound Q&A

What industries use (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid finds applications in the pharmaceutical industry,...

Compound Q&A

What precautions should be taken when handling (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

When handling (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid, it is essential to wear appropriate...

Compound Q&A

What are the main uses of Ethyl N-2-pyridinyl-beta-alaninate (CAS: 103041-38-9)?

Ethyl N-2-pyridinyl-beta-alaninate is primarily used in the pharmaceutical indus...

103041-38-9Ethyl N-2-pyridinyl-...
Compound Q&A

Are there alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1) in synthesis?

There are alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1)...

1211584-54-15H-pyrrolo[3,4-b]pyr...
Compound Q&A

What industries use 2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride (CAS: 1353945-59-1)?

2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride is used in the pha...

1353945-59-12-{[(4-Chlorophenyl)...
Compound Q&A

How should Caesium chloride (CAS: 7647-17-8) be stored?

Caesium chloride should be stored in a cool, dry place (ideally 20-25°C), away f...

7647-17-8Caesium chloride