Compound Q&A

How is (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5) typically synthesized?

Answer

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid
(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid is synthesized through a multi-step process, typically starting with piperazine-2-carboxylic acid. The key steps involve the substitution of the amine groups and the introduction of protecting groups. This synthesis often requires the use of reagents like tert-butyloxycarbonyl (Boc) and fluorenylmethyloxycarbonyl (Fmoc) groups, which are common in peptide chemistry.

About

English Name (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid
Molecular Formula C25H28N2O6
Molecular Weight 452.5070000000002 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24
InChIKey ZVHNNCSUTNWKFC-NRFANRHFSA-N
Last Updated: 2025-11-27 23:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid is a white crystalline solid with a molecular weig...

Compound Q&A

What industries use (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

(S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid finds applications in the pharmaceutical industry,...

Compound Q&A

What precautions should be taken when handling (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid (CAS: 1034574-30-5)?

When handling (S)-1-N-Boc-4-N-Fmoc-piperazine-2-carboxylic acid, it is essential to wear appropriate...

Compound Q&A

What are the main uses of Ethyl N-2-pyridinyl-beta-alaninate (CAS: 103041-38-9)?

Ethyl N-2-pyridinyl-beta-alaninate is primarily used in the pharmaceutical indus...

103041-38-9Ethyl N-2-pyridinyl-...
Compound Q&A

Are there alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1) in synthesis?

There are alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1)...

1211584-54-15H-pyrrolo[3,4-b]pyr...
Compound Q&A

What industries use 2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride (CAS: 1353945-59-1)?

2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride is used in the pha...

1353945-59-12-{[(4-Chlorophenyl)...
Compound Q&A

How should Caesium chloride (CAS: 7647-17-8) be stored?

Caesium chloride should be stored in a cool, dry place (ideally 20-25°C), away f...

7647-17-8Caesium chloride