Compound Q&A

What industries use 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8)?

Answer

5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one
5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) is primarily used in the pharmaceutical industry for the development of various medications, particularly in anticancer and anti-inflammatory drugs. It also has applications in the polymer industry for its potential use in the synthesis of functional polymers with specific properties. Additionally, it is explored for use in sensor technologies and semiconductor materials due to its unique structural features.

About

English Name 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one
Molecular Formula C12H12ClNO2
Molecular Weight 237.69 g/mol
SMILES c1cc2c(cc1Cl)C(=O)OC23CCNCC3
InChIKey SIUBZWCKBKOZMD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8)?

5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) is a colorless to white crys...

Compound Q&A

How is 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) typically synthesized?

5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) is synthesized via an electr...

Compound Q&A

What precautions should be taken when handling 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8)?

5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) should be handled in a well-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...