Compound Q&A

What are the physical and chemical properties of 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8)?

Answer

5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one
5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) is a colorless to white crystalline solid with a molecular weight of approximately 272.7 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetonitrile. It exhibits moderate reactivity, particularly in the presence of nucleophiles and electrophiles. The compound is stable under normal conditions but should be stored away from moisture and heat.

About

English Name 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one
Molecular Formula C12H12ClNO2
Molecular Weight 237.69 g/mol
SMILES c1cc2c(cc1Cl)C(=O)OC23CCNCC3
InChIKey SIUBZWCKBKOZMD-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) typically synthesized?

5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) is synthesized via an electr...

Compound Q&A

What industries use 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8)?

5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling 5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8)?

5-Chloro-3H-spiro[2-benzofuran-1,4'-piperidin]-3-one (CAS: 180160-47-8) should be handled in a well-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...