Compound Q&A

What precautions should be taken when handling AZ12260493 (CAS: 898800-26-5)?

Answer

AZ12260493
When handling AZ12260493, it is crucial to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Ensure the reaction is conducted in a well-ventilated area or a fume hood. Spills should be cleaned up using absorbent materials and disposed of according to local waste regulations. Always consult the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name AZ12260493
Molecular Formula C24H29N3O3S
Molecular Weight 439.58 g/mol
SMILES CC(C)(C)N1C(=O)C(=C(S1(=O)=O)C2=CC=CC=C2)NC3=CC=C(C=C3)N4CCCCC4
InChIKey IVANYIPLGFVBGR-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of AZ12260493 (CAS: 898800-26-5)?

AZ12260493 is a crystalline compound with a molecular weight of approximately 471.36 g/mol. It is sl...

Compound Q&A

How is AZ12260493 (CAS: 898800-26-5) typically synthesized?

AZ12260493 is typically synthesized through a multi-step process involving the coupling of a carboxy...

Compound Q&A

What industries use AZ12260493 (CAS: 898800-26-5)?

AZ12260493 finds applications in the pharmaceutical industry for its potential as an inhibitor in en...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...