Compound Q&A

What are the physical and chemical properties of AZ12260493 (CAS: 898800-26-5)?

Answer

AZ12260493
AZ12260493 is a crystalline compound with a molecular weight of approximately 471.36 g/mol. It is slightly soluble in water but soluble in common organic solvents like DMSO and DMF. Chemically, it is stable under normal conditions but may react with strong acids or bases. Its solubility and stability make it useful in various applications requiring controlled substance handling.

About

English Name AZ12260493
Molecular Formula C24H29N3O3S
Molecular Weight 439.58 g/mol
SMILES CC(C)(C)N1C(=O)C(=C(S1(=O)=O)C2=CC=CC=C2)NC3=CC=C(C=C3)N4CCCCC4
InChIKey IVANYIPLGFVBGR-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is AZ12260493 (CAS: 898800-26-5) typically synthesized?

AZ12260493 is typically synthesized through a multi-step process involving the coupling of a carboxy...

Compound Q&A

What industries use AZ12260493 (CAS: 898800-26-5)?

AZ12260493 finds applications in the pharmaceutical industry for its potential as an inhibitor in en...

Compound Q&A

What precautions should be taken when handling AZ12260493 (CAS: 898800-26-5)?

When handling AZ12260493, it is crucial to wear appropriate personal protective equipment (PPE), inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...