Compound Q&A

What industries use Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3)?

Answer

Methyl 4-(aminomethyl)-3-chlorobenzoate
Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those requiring specific functional groups or structural motifs. It is also used in the polymer industry as a monomer for the development of novel materials with specific properties. Additionally, it has applications in the production of sensors and semiconductors due to its unique chemical properties.

About

English Name Methyl 4-(aminomethyl)-3-chlorobenzoate
Molecular Formula C9H10ClNO2
Molecular Weight 199.64 g/mol
SMILES COC(=O)C1=CC(=C(C=C1)CN)Cl
InChIKey VXLLMVXXEXMLNL-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3)?

Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3) is a crystalline compound with a molecula...

Compound Q&A

How is Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3) typically synthesized?

Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3) is typically synthesized through a reacti...

Compound Q&A

What precautions should be taken when handling Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3)?

When handling Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3), it is important to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...