Compound Q&A

How is Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3) typically synthesized?

Answer

Methyl 4-(aminomethyl)-3-chlorobenzoate
Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3) is typically synthesized through a reaction of 3-chlorobenzoic acid with methylamine followed by esterification. The synthesis involves condensation of 3-chlorobenzoic acid with methylamine to form the amide, which is then esterified with methanol in the presence of a catalyst like sulfuric acid. The yield is typically around 85-90%, with good selectivity towards the desired product.

About

English Name Methyl 4-(aminomethyl)-3-chlorobenzoate
Molecular Formula C9H10ClNO2
Molecular Weight 199.64 g/mol
SMILES COC(=O)C1=CC(=C(C=C1)CN)Cl
InChIKey VXLLMVXXEXMLNL-UHFFFAOYSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3)?

Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3) is a crystalline compound with a molecula...

Compound Q&A

What industries use Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3)?

Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3)?

When handling Methyl 4-(aminomethyl)-3-chlorobenzoate (CAS: 940062-11-3), it is important to use pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...