Compound Q&A

How is Lactonic Sophorolipid (CAS: 148409-20-5) typically synthesized?

Answer

Lactonic Sophorolipid
Lactonic Sophorolipid is typically synthesized through a fermentation process utilizing Candida utilis, a yeast species, where it ferments glucose to produce sophorolipids. These can be further transformed into lactonic sophorolipids through a lactonization reaction using a strong acid catalyst, such as concentrated sulfuric acid. The process yields high selectivity and is known for its high efficiency and low environmental impact.

About

English Name Lactonic Sophorolipid
Molecular Formula C34H56O14
Molecular Weight 688.8000 g/mol
SMILES CC(=O)OC[C@H]1O[C@H]2O[C@H]3[C@H](O[C@@H](C)CCCCCC/C=C/CCCCCCCC(=O)O[C@H]1[C@@H]([C@H]2O)O)O[C@@H]([C@H]([C@@H]3O)O)COC(=O)C
InChIKey OGTXYHUVJIPSDT-NQYXFMOLSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lactonic Sophorolipid (CAS: 148409-20-5)?

Lactonic Sophorolipid is a biologically derived compound with a molecular weight of approximately 10...

Compound Q&A

What industries use Lactonic Sophorolipid (CAS: 148409-20-5)?

Lactonic Sophorolipid finds application in a variety of industries, including pharmaceuticals for su...

Compound Q&A

What precautions should be taken when handling Lactonic Sophorolipid (CAS: 148409-20-5)?

When handling Lactonic Sophorolipid, it is important to wear appropriate personal protective equipme...

Compound Q&A

What are the main uses of 1H-Indazole-6-carbonitrile (CAS: 141290-59-7)?

1H-Indazole-6-carbonitrile finds applications in pharmaceuticals, where it serve...

141290-59-71H-Indazole-6-carbon...
Compound Q&A

How should waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) be handled?

Waste containing Dioctyl (2E)-2-butenedioate (CAS: 2997-85-5) should be collecte...

2997-85-5Dioctyl (2E)-2-buten...
Compound Q&A

What industries use Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide (CAS: 68291-98-5)?

Sodium [(1,2-benzoxazol-3-ylmethyl)sulfonyl]azanide is primarily used in pharmac...

68291-98-5Sodium [(1,2-benzoxa...
Compound Q&A

Are there alternatives to Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxylate (CAS: 741709-66-0) in synthesis?

Dimethyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,6-pyridinedicarboxyla...

741709-66-0Dimethyl 4-(4,4,5,5-...