Compound Q&A

What are the physical and chemical properties of Lactonic Sophorolipid (CAS: 148409-20-5)?

Answer

Lactonic Sophorolipid
Lactonic Sophorolipid is a biologically derived compound with a molecular weight of approximately 1000 Da. It exhibits good solubility in organic solvents such as ethanol and is less soluble in water. Chemically, it is highly reactive towards nucleophilic substitution and can form stable complexes with metal ions. It crystallizes in a hexagonal form at low temperatures, making it suitable for use in various applications due to its unique physicochemical properties.

About

English Name Lactonic Sophorolipid
Molecular Formula C34H56O14
Molecular Weight 688.8 g/mol
SMILES CC(=O)OC[C@H]1O[C@H]2O[C@H]3[C@H](O[C@@H](C)CCCCCC/C=C/CCCCCCCC(=O)O[C@H]1[C@@H]([C@H]2O)O)O[C@@H]([C@H]([C@@H]3O)O)COC(=O)C
InChIKey OGTXYHUVJIPSDT-NQYXFMOLSA-N
Last Updated: 2025-11-27 19:31

Related Q&A

Compound Q&A

How is Lactonic Sophorolipid (CAS: 148409-20-5) typically synthesized?

Lactonic Sophorolipid is typically synthesized through a fermentation process utilizing Candida util...

Compound Q&A

What industries use Lactonic Sophorolipid (CAS: 148409-20-5)?

Lactonic Sophorolipid finds application in a variety of industries, including pharmaceuticals for su...

Compound Q&A

What precautions should be taken when handling Lactonic Sophorolipid (CAS: 148409-20-5)?

When handling Lactonic Sophorolipid, it is important to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...